Name |
Asebogenin asmaxanthone |
Formula |
C16H16O5 |
Mw |
288.09977362 |
CAS RN |
520-42-3 |
C_ID |
C00000940
,
|
InChIKey |
UPXIBKPHJYQSGP-UHFFFAOYSA-N |
InChICode |
InChI=1S/C16H16O5/c1-21-12-8-14(19)16(15(20)9-12)13(18)7-4-10-2-5-11(17)6-3-10/h2-3,5-6,8-9,17,19-20H,4,7H2,1H3 |
SMILES |
c1(cc(c(c(c1)O)C(=O)CCc1ccc(cc1)O)O)OC |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia rigida | Ref. |
Plantae | Ericaceae | Lyonia formosa | Ref. |
Plantae | Ericaceae | Pieris japonica | Ref. |
Plantae | Ericaceae | Rhododendron spp. | Ref. |
Plantae | Hydrocharitaceae | Thalassia ciliatum | Ref. |
Plantae | Myristicaceae | Iryanthera laevis | Ref. |
Plantae | Piperaceae | Piper aduncum | Ref. |
Plantae | Pteridaceae | Adiantum poretti | Ref. |
Plantae | Pteridaceae | Cheilanthes welwitschii | Ref. |
Plantae | Pteridaceae | Notholaena lemmonii | Ref. |
Plantae | Pteridaceae | Notholaena sulphurea | Ref. |
Plantae | Pteridaceae | Pityrogramma calomelanos | Ref. |
Plantae | Salicaceae | Populus x jackii | Ref. |
|
|
zoom in
Organism | Garcinia rigida | Reference | Aravind, A. P. A et al., Diversity of Garcinia species in the Western Ghats: Phytochemical Perspective, Chapter 2, (2016), p.19-70. |
---|
|