Name |
Genkwanin |
Formula |
C16H12O5 |
Mw |
284.06847349 |
CAS RN |
437-64-9 |
C_ID |
C00001043
, 
|
InChIKey |
JPMYFOBNRRGFNO-UHFFFAOYSA-N |
InChICode |
InChI=1S/C16H12O5/c1-20-11-6-12(18)16-13(19)8-14(21-15(16)7-11)9-2-4-10(17)5-3-9/h2-8,17-18H,1H3 |
SMILES |
c1(cc(c2c(c1)oc(cc2=O)c1ccc(cc1)O)O)OC |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Asteraceae | Artemisia capillaris  | Ref. |
Plantae | Fabaceae | Acacia constricta | Ref. |
Plantae | Fabaceae | Glycyrrhiza glabra  | Ref. |
Plantae | Fabaceae | Glycyrrhiza inflata  | Ref. |
Plantae | Fabaceae | Glycyrrhiza uralensis  | Ref. |
Plantae | Fabaceae | Medicago polymorpha  | Ref. |
Plantae | Fabaceae | Mimosa hostilis | Ref. |
Plantae | Hydrocharitaceae | Halophila stipulacea | Ref. |
Plantae | Labiatae | Ocimum americanum L.var.pilosum (Willd.) Paton  | Ref. |
Plantae | Labiatae | Ocimum basilicum L.  | Ref. |
Plantae | Labiatae | Ocimum kilimandscharicum L.  | Ref. |
Plantae | Labiatae | Ocimum selloi Benth.  | Ref. |
Plantae | Labiatae | Ocimum x citriodorum Vis. | Ref. |
Plantae | Labiatae | Plectranthus fruticosus | Ref. |
Plantae | Labiatae | Rosmarinus officinalis  | Ref. |
Plantae | Labiatae | Salvia dorrii | Ref. |
Plantae | Labiatae | Salvia glutinosa  | Ref. |
Plantae | Labiatae | Salvia lavandulaefolia | Ref. |
Plantae | Labiatae | Salvia lavandulifolia  | Ref. |
Plantae | Labiatae | Salvia microsiphon | Ref. |
Plantae | Labiatae | Salvia nicolsoniana | Ref. |
Plantae | Labiatae | Salvia officinalis  | Ref. |
Plantae | Labiatae | Salvia palaestina | Ref. |
Plantae | Labiatae | Salvia sapinae | Ref. |
Plantae | Labiatae | Salvia stenophylla  | Ref. |
Plantae | Labiatae | Salvia yosgadensis | Ref. |
Plantae | Labiatae | Teucrium ramosissimum | Ref. |
Plantae | Pteridaceae | Cheilanthes albomarginata  | Ref. |
Plantae | Pteridaceae | Cheilanthes rufa | Ref. |
Plantae | Thymelaeaceae | Daphne genkwa  | Ref. |
Plantae | Zygophyllaceae | Larrea divaricata  | Ref. |
Plantae | Zygophyllaceae | Larrea tridentata  | Ref. |
- | - | Syphopappus polystachyus | Ref. |
|
|
zoom in
Organism | Artemisia capillaris | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Harbone, Comparative Biochemisty of the Flavonoids,(1965),39, Academic Press
Sakakibara,Phytochem.,15,(1976),727 |
---|
|