| Name |
Isoscoparin
Isoorientin 3'-methyl ether |
| Formula |
C22H22O11 |
| Mw |
462.11621155 |
| CAS RN |
20013-23-4 |
| C_ID |
C00001058
, 
|
| InChIKey |
KOMUHHCFAXYRPO-FPRNEBIWNA-N |
| InChICode |
InChI=1S/C22H22O11/c1-31-13-4-8(2-3-9(13)24)12-5-10(25)16-14(32-12)6-11(26)17(19(16)28)22-21(30)20(29)18(27)15(7-23)33-22/h2-6,15,18,20-24,26-30H,7H2,1H3/t15-,18-,20+,21-,22+/m1/s1 |
| SMILES |
c1(c(c(c2c(c1)oc(cc2=O)c1cc(c(cc1)O)OC)O)[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Araceae | Lemna minor | Ref. |
| Plantae | Asteraceae | Haplopappus spp. | Ref. |
| Plantae | Caryophyllaceae | Silene spp. | Ref. |
| Plantae | Cruciferae | Isatis tinctoria  | Ref. |
| Plantae | Gentianaceae | Gentiana decumbers | Ref. |
| Plantae | Gentianaceae | Gentiana macrophylla | Ref. |
| Plantae | Gentianaceae | Gentiana punctata L. | Ref. |
| Plantae | Gentianaceae | Gentiana spp. | Ref. |
| Plantae | Gentianaceae | Gentiana triflora | Ref. |
| Plantae | Potamogetonaceae | Potamogeton natans | Ref. |
|
|
zoom in
| Organism | Lemna minor |
|---|
| Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 549,C-glycosylflavones
Boutard,C.R.Acad.Sci.Ser.D.,274,(1972),1099 |
|---|
|
