| Name |
Raffinose |
| Formula |
C18H32O16 |
| Mw |
504.16903498 |
| CAS RN |
512-69-6 |
| C_ID |
C00001145
, 
|
| InChIKey |
MUPFEKGTMRGPLJ-WZHGAKAXNA-N |
| InChICode |
InChI=1S/C18H32O16/c19-1-5-8(22)11(25)13(27)16(31-5)30-3-7-9(23)12(26)14(28)17(32-7)34-18(4-21)15(29)10(24)6(2-20)33-18/h5-17,19-29H,1-4H2/t5-,6-,7+,8+,9-,10+,11+,12+,13-,14-,15-,16+,17-,18+/m1/s1 |
| SMILES |
[C@H]1([C@@H]([C@H]([C@H](O[C@@H]1CO)OC[C@H]1[C@H]([C@@H]([C@H]([C@H](O1)O[C@]1([C@@H]([C@H]([C@H](O1)CO)O)O)CO)O)O)O)O)O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Araliaceae | Panax ginseng  | Ref. |
| Plantae | Caricaceae | Carica papaya | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cruciferae | Brassica oleracea L. ssp. Botrytis | Ref. |
| Plantae | Fabaceae | Vicia faba | Ref. |
| Plantae | Myrtaceae | Syzygium cumini | Ref. |
| Plantae | Plantaginaceae | Plantago asiatica | Ref. |
| Plantae | Rosaceae | Prunus avium | Ref. |
| Plantae | Scrophulariaceae | Rehmannia glutinosa | Ref. |
| Plantae | Taxaceae | Taxus baccata | Ref. |
| - | - | FOOD SAKE | Ref. |
|
|
zoom in
| Organism | Panax ginseng |
|---|
| Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|
