| Name |
Quinquangulin |
| Formula |
C16H14O5 |
| Mw |
286.08412356 |
| CAS RN |
64894-58-2 |
| C_ID |
C00002444
, 
|
| InChIKey |
PMPFXXWLTIMSFY-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H14O5/c1-7-4-10(17)14-12(21-7)6-9-5-11(20-3)8(2)15(18)13(9)16(14)19/h4-6,18-19H,1-3H3 |
| SMILES |
c12c(c(c(c(c1)OC)C)O)c(c1c(c2)oc(cc1=O)C)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Cassia quinquangula | Ref. |
| Plantae | Fabaceae | Cassia quinquangulata | Ref. |
| Plantae | Fabaceae | Senna obliqua | Ref. |
| Plantae | Fabaceae | Senna quinquangulata  | Ref. |
|
|
zoom in
| Organism | Cassia quinquangula |
|---|
| Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|
