| Name |
Sinapic acid |
| Formula |
C11H12O5 |
| Mw |
224.06847349 |
| CAS RN |
530-59-6 |
| C_ID |
C00002776
, 
|
| InChIKey |
PCMORTLOPMLEFB-ONEGZZNKSA-N |
| InChICode |
InChI=1S/C11H12O5/c1-15-8-5-7(3-4-10(12)13)6-9(16-2)11(8)14/h3-6,14H,1-2H3,(H,12,13)/b4-3+ |
| SMILES |
c1(c(c(cc(c1)/C=C/C(=O)O)OC)O)OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Alliaceae | Allium cepa  | Ref. |
| Plantae | Apiaceae | Foeniculum vulgare | Ref. |
| Plantae | Apocynaceae | Cynanchum thesioides | Ref. |
| Plantae | Aquifoliaceae | Ilex paraguariensis | Ref. |
| Plantae | Aristolochiaceae | Aristolochia clematis | Ref. |
| Plantae | Aristolochiaceae | Asarum europaeum | Ref. |
| Plantae | Asteraceae | Matricaria chamomilla | Ref. |
| Plantae | Asteraceae | Rhaponticum carthamoides | Ref. |
| Plantae | Capparaceae | Capparis spinosa | Ref. |
| Plantae | Caricaceae | Carica papaya | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cruciferae | Brassica carinata B line | Ref. |
| Plantae | Cruciferae | Brassica carinata Y line | Ref. |
| Plantae | Cruciferae | Brassica juncea | Ref. |
| Plantae | Cruciferae | Brassica oleracea | Ref. |
| Plantae | Cruciferae | Isatis tinctoria | Ref. |
| Plantae | Cruciferae | Lepidium sativum | Ref. |
| Plantae | Cruciferae | Raphanus sativus | Ref. |
| Plantae | Cruciferae | Sisymbrium columnae | Ref. |
| Plantae | Ericaceae | Erica australis | Ref. |
| Plantae | Fabaceae | Pterocarpus santalinus | Ref. |
| Plantae | Fabaceae | Vicia faba | Ref. |
| Plantae | Labiatae | Ocimum sanctum | Ref. |
| Plantae | Magnoliaceae | Magnolia denudata | Ref. |
| Plantae | Magnoliaceae | Magnolia liliiflora | Ref. |
| Plantae | Poaceae | Triticum aestivum | Ref. |
| Plantae | Polygonaceae | Calligonum leucocladum | Ref. |
| Plantae | Posidoniaceae | Posidonia oceanica | Ref. |
| Plantae | Rosaceae | Prunus avium | Ref. |
| Plantae | Rutaceae | Citrus limon | Ref. |
| Plantae | Rutaceae | Citrus limonia | Ref. |
| Plantae | Salicaceae | Populus trichocarpa | Ref. |
| Plantae | Solanaceae | Solanum tuberosum | Ref. |
| Plantae | Urticaceae | Urtica dioica | Ref. |
| Plantae | Vitaceae | Vitis vinifera | Ref. |
| - | - | Antitoxicum scanden | Ref. |
| - | - | FOOD SAKE | Ref. |
|
|
zoom in
| Organism | Allium cepa |
|---|
| Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11 |
|---|
|
