| Name |
1-Hydroxy-2-methoxyanthraquinone
Alizarin 2-methyl ether
Alizarin-2-methyl ether |
| Formula |
C15H10O4 |
| Mw |
254.05790881 |
| CAS RN |
6003-11-8 |
| C_ID |
C00002786
, 
|
| InChIKey |
BYQWRZGQEZAOPQ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H10O4/c1-19-11-7-6-10-12(15(11)18)14(17)9-5-3-2-4-8(9)13(10)16/h2-7,18H,1H3 |
| SMILES |
c1ccc2c(c1)C(=O)c1c(C2=O)ccc(c1O)OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rubiaceae | Asperula odorata  | Ref. |
| Plantae | Rubiaceae | Cinchona spp. | Ref. |
| Plantae | Rubiaceae | Galium spp. | Ref. |
| Plantae | Rubiaceae | Morinda citrifolia | Ref. |
| Plantae | Rubiaceae | Morinda umbellata | Ref. |
| Plantae | Rubiaceae | Rubia cordifolia | Ref. |
| Plantae | Rubiaceae | Rubia tinctorum | Ref. |
| Plantae | Rubiaceae | Rubia wallichiana DECNE | Ref. |
|
|
zoom in
| Organism | Asperula odorata |
|---|
| Reference | WU, et al., Chem Pharm Bull, 51, (2003), 948.
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter43 |
|---|
|
