| Name |
Norswertianolin |
| Formula |
C19H18O11 |
| Mw |
422.08491142 |
| CAS RN |
54954-12-0 |
| C_ID |
C00002971
, 
|
| InChIKey |
BSRHOZLFHFZAQA-MMKAPXODNA-N |
| InChICode |
InChI=1S/C19H18O11/c20-5-10-14(24)16(26)17(27)19(30-10)29-9-4-2-7(22)18-12(9)15(25)11-8(28-18)3-1-6(21)13(11)23/h1-4,10,14,16-17,19-24,26-27H,5H2/t10-,14+,16+,17-,19-/m1/s1 |
| SMILES |
c1cc(c2c(c1O)oc1c(c2=O)c(c(cc1)O)O)O[C@H]1[C@@H]([C@H]([C@H]([C@H](O1)CO)O)O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Gentianaceae | Gentiana campestris | Ref. |
| Plantae | Gentianaceae | Swertia japonica  | Ref. |
| Plantae | Gentianaceae | Swertia purpurascens | Ref. |
| Plantae | Gentianaceae | Swertia randainensis | Ref. |
|
|
zoom in
| Organism | Gentiana campestris |
|---|
| Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Urbain, et al., Planta Med, 70, (2004), 1011 |
|---|
|
