| Name |
cis-alpha-Irone |
| Formula |
C14H22O |
| Mw |
206.16706532 |
| CAS RN |
35124-13-1 |
| C_ID |
C00003153
, 
|
| InChIKey |
JZQOJFLIJNRDHK-JRZCNNEFNA-N |
| InChICode |
InChI=1S/C14H22O/c1-10-6-7-11(2)14(4,5)13(10)9-8-12(3)15/h6,8-9,11,13H,7H2,1-5H3/b9-8+/t11-,13+/m1/s1 |
| SMILES |
[C@H]1(CC=C([C@@H](C1(C)C)/C=C/C(=O)C)C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Iridaceae | Iris florentina | Ref. |
|
|
zoom in
| Organism | Iris florentina |
|---|
| Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998)
Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter50 |
|---|
|
