| Name |
Pristimerin |
| Formula |
C30H40O4 |
| Mw |
464.29265977 |
| CAS RN |
1258-84-0 |
| C_ID |
C00003753
, 
|
| InChIKey |
JFACETXYABVHFD-OBOKJLQFNA-N |
| InChICode |
InChI=1S/C30H40O4/c1-18-19-8-9-22-28(4,20(19)16-21(31)24(18)32)13-15-30(6)23-17-27(3,25(33)34-7)11-10-26(23,2)12-14-29(22,30)5/h8-9,16,23,32H,10-15,17H2,1-7H3/t23-,26-,27-,28+,29-,30+/m1/s1 |
| SMILES |
C1(=O)C(=C(C2=CC=C3[C@](C2=C1)(CC[C@@]1([C@@]3(CC[C@@]2([C@H]1C[C@](CC2)(C)C(=O)OC)C)C)C)C)C)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Celastraceae | Catha edulis  | Ref. |
| Plantae | Celastraceae | Cheiloclinium cognatum | Ref. |
| Plantae | Celastraceae | Crossopetalum gaumeri | Ref. |
| Plantae | Celastraceae | Maytenus aquifolium | Ref. |
| Plantae | Celastraceae | Maytenus canariensis | Ref. |
| Plantae | Celastraceae | Maytenus chuchuhuasca | Ref. |
| Plantae | Celastraceae | Maytenus illicifolia Mart ex Reiss. | Ref. |
| Plantae | Celastraceae | Maytenus spp. | Ref. |
| Plantae | Celastraceae | Pristimera indica | Ref. |
| Plantae | Celastraceae | Salacia campestris | Ref. |
| Plantae | Celastraceae | Salacia kraussii | Ref. |
| Plantae | Celastraceae | Schaefferia cuneifolia | Ref. |
| Plantae | Celastraceae | Tripterygium regelii | Ref. |
|
|
zoom in
| Organism | Catha edulis |
|---|
| Reference | Ji, et al., Pharmacological Action and Application of Available Antitumor Composition of Traditional Chinese Medicine, Heilongjiang Science and technology Press, Heilongjiang, (1998).
Wang, et al., Handbook of Effective Components in Vegetal Medicines, People Health Press, Beijing, (1986).
Ankli, et al., Phytochemistry, 54, (2000), 531.
Calixto, et al., Planta Med, 70, (2004), 93.
Calixto, et al., Planta Med, 69, (2003), 973
Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter59 |
|---|
|
