| Name |
Acacetin 7-(4'''-acetylrutinoside)
Linarin monoacetate
7-[[6-O-(4-O-acetyl-6-deoxy-alpha-L-mannopyranosyl)-beta-D-glucopyranosyl]oxy]-5-hydroxy-2-(4-methoxyphenyl)-4H-1-benzopyran-4-one |
| Formula |
C30H34O15 |
| Mw |
634.18977042 |
| CAS RN |
79541-06-3 |
| C_ID |
C00004210
, 
|
| InChIKey |
QZOBONFUOPKXNI-BNZLMPRJNA-N |
| InChICode |
InChI=1S/C30H34O15/c1-12-28(42-13(2)31)25(36)27(38)29(41-12)40-11-21-23(34)24(35)26(37)30(45-21)43-16-8-17(32)22-18(33)10-19(44-20(22)9-16)14-4-6-15(39-3)7-5-14/h4-10,12,21,23-30,32,34-38H,11H2,1-3H3/t12-,21-,23+,24+,25-,26-,27-,28+,29-,30-/m1/s1 |
| SMILES |
c1(cc(c2c(c1)oc(cc2=O)c1ccc(cc1)OC)O)O[C@H]1[C@@H]([C@H]([C@H]([C@H](O1)CO[C@H]1[C@@H]([C@H]([C@H]([C@H](O1)C)OC(=O)C)O)O)O)O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Ranunculaceae | Thalictrum aquilegifolium  | Ref. |
| Plantae | Ranunculaceae | Thalictrum przewalskii | Ref. |
|
|
zoom in
| Organism | Thalictrum aquilegifolium |
|---|
| Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 3.Flavone O-glycosides, John Wiley & Son
Ina,Phytochem.,20,(1981),1176 |
|---|
|
