| Name |
Quercetin 7-rhamnoside |
| Formula |
C21H20O11 |
| Mw |
448.10056148 |
| CAS RN |
22007-72-3 |
| C_ID |
C00005383
, 
|
| InChIKey |
QPHXPNUXTNHJOF-YAGZWMEWNA-N |
| InChICode |
InChI=1S/C21H20O11/c1-7-15(25)17(27)19(29)21(30-7)31-9-5-12(24)14-13(6-9)32-20(18(28)16(14)26)8-2-3-10(22)11(23)4-8/h2-7,15,17,19,21-25,27-29H,1H3/t7-,15-,17-,19+,21-/m0/s1 |
| SMILES |
c1(cc(c2c(c1)oc(c(c2=O)O)c1ccc(c(c1)O)O)O)O[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)C)O)O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apocynaceae | Vincetoxicum officinale | Ref. |
| Plantae | Crassulaceae | Sedum caucasicum | Ref. |
| Plantae | Crassulaceae | Sedum telephium  | Ref. |
| Plantae | Cupressaceae | Thuja orientalis | Ref. |
| Plantae | Equisetaceae | Equisetum silvaticum | Ref. |
| Plantae | Fabaceae | Lotus corniculatus | Ref. |
| Plantae | Hypericaceae | Hypericum japonicum | Ref. |
| Plantae | Orchidaceae | Orchis papilionacea | Ref. |
| Plantae | Saururaceae | Houttuynia cordata | Ref. |
|
|
zoom in
| Organism | Vincetoxicum officinale |
|---|
| Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Kozjek,C.R.Acad.Sci.Paris.Ser.D.,264,(1967),2409
Kozjek,Ann,Pharm.Fr.,26,(1968),513 |
|---|
|
