Name |
Isomyricitrin Myricetin 3-O-beta-D-glucopyranoside Myricetin 3-O-beta-D-glucoside Myricetin 3-glucoside |
Formula |
C21H20O13 |
Mw |
480.09039073 |
CAS RN |
19833-12-6 |
C_ID |
C00005729
, 
|
InChIKey |
FOHXFLPXBUAOJM-AXXBMTQMNA-N |
InChICode |
InChI=1S/C21H20O13/c22-5-12-15(28)17(30)18(31)21(33-12)34-20-16(29)13-8(24)3-7(23)4-11(13)32-19(20)6-1-9(25)14(27)10(26)2-6/h1-4,12,15,17-18,21-28,30-31H,5H2/t12-,15-,17+,18-,21+/m1/s1 |
SMILES |
c1(cc(c2c(c1)oc(c(c2=O)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)c1cc(c(c(c1)O)O)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Asteraceae | Tagetes elliptica  | Ref. |
Plantae | Cistaceae | Cistus ladaniferus  | Ref. |
Plantae | Crassulaceae | Sedum kamtschaticum  | Ref. |
Plantae | Cunoniaceae | Davidsonia pruriens  | Ref. |
Plantae | Euphorbiaceae | Euphorbia stepposa | Ref. |
Plantae | Fabaceae | Acacia aroma  | Ref. |
Plantae | Fabaceae | Acacia dealbata | Ref. |
Plantae | Fabaceae | Acacia latifolia | Ref. |
Plantae | Fabaceae | Acacia mearnsii  | Ref. |
Plantae | Fabaceae | Clitoria ternatea  | Ref. |
Plantae | Fabaceae | Dorycnium pentaphyllum | Ref. |
Plantae | Fabaceae | Medicago arborea | Ref. |
Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
Plantae | Fabaceae | Prosopis argentina | Ref. |
Plantae | Fabaceae | Prosopis reptans | Ref. |
Plantae | Fabaceae | Vigna spp. | Ref. |
Plantae | Geraniaceae | Pelargonium reniforme | Ref. |
Plantae | Hamamelidaceae | Liquidambar formosana  | Ref. |
Plantae | Iridaceae | Patersonia spp. | Ref. |
Plantae | Marantaceae | Calathea angustifolia | Ref. |
Plantae | Myrsinaceae | Lysimachia punctata | Ref. |
Plantae | Nymphaeaceae | Nymphaea caerulea | Ref. |
Plantae | Onagraceae | Heterogaura heterandra | Ref. |
Plantae | Plumbaginaceae | Plumbago spp. | Ref. |
Plantae | Primulaceae | Primula sinensis | Ref. |
Plantae | Saxifragaceae | Heuchera spp. | Ref. |
Plantae | Saxifragaceae | Leptarrhena pyrolifolia | Ref. |
Plantae | Saxifragaceae | Lithophragma spp. | Ref. |
Plantae | Theaceae | Camellia sinensis  | Ref. |
Plantae | Typhaceae/Sparganiaceae | Sparganium erectum | Ref. |
|
|
zoom in
Organism | Tagetes elliptica | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Harborne,Biochem.J.,78,(1961),298
Sotnikova,Khim.Prir.Soedin.,4,(1968),50 |
---|
|