| Name |
Bonanniol A |
| Formula |
C25H28O6 |
| Mw |
424.18858863 |
| CAS RN |
96917-35-0 |
| C_ID |
C00008647
, 
|
| InChIKey |
WCWOWFQELCQQCI-DQONRBRVNA-N |
| InChICode |
InChI=1S/C25H28O6/c1-14(2)5-4-6-15(3)7-12-18-19(27)13-20-21(22(18)28)23(29)24(30)25(31-20)16-8-10-17(26)11-9-16/h5,7-11,13,24-28,30H,4,6,12H2,1-3H3/b15-7+/t24-,25+/m1/s1 |
| SMILES |
c1(c(c2c(cc1O)O[C@H]([C@@H](C2=O)O)c1ccc(cc1)O)O)C/C=C(/CCC=C(C)C)\C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Bonannia graeca | Ref. |
| Plantae | Euphorbiaceae | Macaranga alnifolia | Ref. |
| Plantae | Sarcolaenaceae | Schizolaena hystrix | Ref. |
|
|
zoom in
| Organism | Bonannia graeca |
|---|
| Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 769,Flavanones and dihydroflavonols
Bruno,Heterocycles,23,(1985),1147 |
|---|
|
