Name |
Erythrabyssin II 3,9-Dihydroxy-2,10-diprenylpterocarpan |
Formula |
C25H28O4 |
Mw |
392.19875938 |
CAS RN |
77263-06-0 |
C_ID |
C00009669
,
|
InChIKey |
LDKAMVCGTURXMH-UHFFFAOYNA-N |
InChICode |
InChI=1S/C25H28O4/c1-14(2)5-7-16-11-19-23(12-22(16)27)28-13-20-17-9-10-21(26)18(8-6-15(3)4)24(17)29-25(19)20/h5-6,9-12,20,25-27H,7-8,13H2,1-4H3/t20-,25-/m0/s1 |
SMILES |
c1(c(cc2c(c1)OC[C@@H]1[C@H]2Oc2c1ccc(c2CC=C(C)C)O)CC=C(C)C)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Fabaceae | Erythrina abyssinica | Ref. |
Plantae | Fabaceae | Erythrina burttii | Ref. |
Plantae | Fabaceae | Erythrina orientalis | Ref. |
Plantae | Fabaceae | Erythrina poeppigiana | Ref. |
Plantae | Fabaceae | Erythrina sigmoidea | Ref. |
Plantae | Fabaceae | Erythrina suberosa var. glabrescences | Ref. |
Plantae | Fabaceae | Erythrina subumbrans | Ref. |
Plantae | Fabaceae | Erythrina variegata | Ref. |
Plantae | Fabaceae | Erythrina x bidwillii | Ref. |
Plantae | Fabaceae | Erythrina zeyheri | Ref. |
Plantae | Fabaceae | Lespedeza floribunda | Ref. |
Plantae | Fabaceae | Phaseolus lunatus | Ref. |
Plantae | Fabaceae | Sophora prostrata | Ref. |
|
|
zoom in
Organism | Erythrina abyssinica | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Kamat,Heterocycles,15,(1981),1163 |
---|
|