| Name |
Clionasterol
gamma-Sitosterol |
| Formula |
C29H50O |
| Mw |
414.38616622 |
| CAS RN |
83-47-6 |
| C_ID |
C00023769
, 
|
| InChIKey |
KZJWDPNRJALLNS-XNMQMIFBNA-N |
| InChICode |
InChI=1S/C29H50O/c1-7-21(19(2)3)9-8-20(4)25-12-13-26-24-11-10-22-18-23(30)14-16-28(22,5)27(24)15-17-29(25,26)6/h10,19-21,23-27,30H,7-9,11-18H2,1-6H3/t20-,21+,23+,24+,25-,26+,27+,28+,29-/m1/s1 |
| SMILES |
C1[C@@H](CC2=CC[C@@H]3[C@@H]([C@]2(C1)C)CC[C@]1([C@H]3CC[C@@H]1[C@@H](CC[C@@H](C(C)C)CC)C)C)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Amoebozoa | Physaridae | Physarum flavicomum | Ref. |
| Amoebozoa | Physaridae | Physarum polycephalum | Ref. |
| Chromalveolata | Heterosigmataceae | Heterosigma akashiwo | Ref. |
| Plantae | Acoraceae | Acorus calanus L. | Ref. |
| Plantae | Apiaceae | Peucedanum rubricaule | Ref. |
| Plantae | Asteraceae | Gynura segetum | Ref. |
| Plantae | Cruciferae | Isatis indigotica  | Ref. |
| Plantae | Polygonaceae | Polygonum bistorta | Ref. |
| Plantae | Rutaceae | Citrus limonia | Ref. |
| Plantae | Verbenaceae | Clerodendron cyrtophyllum | Ref. |
| - | - | Chloromorum toxicum | Ref. |
|
|
zoom in
| Organism | Physarum flavicomum |
|---|
| Reference | Nes,Analysis of Sterols and Other Biologically Significant Steroids
Academic Press Inc.,New York,Ny,341 pp.(1989)
Seitz,J.Agric.Food Chem.,25,(1977),838-841
Turner,Fungal Metabolites II
Academic Press,New York,NY,631 pp.(1983)
Weete,Structure and Function |
|---|
|
