| Name |
N-Methylhernangerine
(+)-N-Methylhernangerine |
| Formula |
C19H19NO4 |
| Mw |
325.1314081 |
| CAS RN |
5544-68-3 |
| C_ID |
C00033252
, 
|
| InChIKey |
WOIZHRXESCUSGM-STGVRZAANA-N |
| InChICode |
InChI=1S/C19H19NO4/c1-20-6-5-11-8-14-19(24-9-23-14)17-15(11)12(20)7-10-3-4-13(21)18(22-2)16(10)17/h3-4,8,12,21H,5-7,9H2,1-2H3/t12-/m0/s1 |
| SMILES |
c12c(C[C@H]3c4c1c1c(cc4CCN3C)OCO1)ccc(c2OC)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Hernandiaceae | Hernandia Sonora | Ref. |
| Plantae | Hernandiaceae | Hernandia ovigera L.  | Ref. |
| Plantae | Lauraceae | Lindera chunii | Ref. |
| Plantae | Lauraceae | Lindera megaphylla | Ref. |
|
|
zoom in
| Organism | Hernandia Sonora |
|---|
| Reference | Lu, et al., J of Pharm Society(Japan), 92, (1972), 910.
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
ZHANG, et al., Chem Pharm Bull, 50, (2002), 1195 |
|---|
|
