| Name |
Menthone |
| Formula |
C10H18O |
| Mw |
154.1357652 |
| CAS RN |
89-80-5 |
| C_ID |
C00035341
, 
|
| InChIKey |
NFLGAXVYCFJBMK-FWXGUSLSNA-N |
| InChICode |
InChI=1S/C10H18O/c1-7(2)9-5-4-8(3)6-10(9)11/h7-9H,4-6H2,1-3H3/t8-,9-/m1/s1 |
| SMILES |
C1[C@@H](CC[C@@H](C1=O)C(C)C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Echinops grijsii | Ref. |
| Plantae | Crassulaceae | Rhodiola rosea L.  | Ref. |
| Plantae | Fabaceae | Tipuana tipu | Ref. |
| Plantae | Geraniaceae | Pelargonium graveolens | Ref. |
| Plantae | Geraniaceae | Pelargonium tomentosum | Ref. |
| Plantae | Labiatae | Cunila angustifolia | Ref. |
| Plantae | Labiatae | Mentha haplocalyx | Ref. |
| Plantae | Labiatae | Mentha pulegium L. | Ref. |
| Plantae | Labiatae | Perilla frutescens var.acuta | Ref. |
| Plantae | Labiatae | Satureja douglasii | Ref. |
| Plantae | Labiatae | Schizonepeta tenuifolia | Ref. |
| Plantae | Lamiaceae | Calamintha nepeta | Ref. |
| Plantae | Plagiochilaceae | Plagiochila rutilans | Ref. |
|
|
zoom in
| Organism | Echinops grijsii |
|---|
| Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Ou, et al., Brief Handbook of Components of Traditional Chinese Medicines, The People's Medical Publishing House, Beijing, (2003) |
|---|
|
