| Name |
Moracin B |
| Formula |
C16H14O5 |
| Mw |
286.08412356 |
| CAS RN |
67259-16-9 |
| C_ID |
C00036148
, 
|
| InChIKey |
GOUSNRMGQRTROZ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H14O5/c1-19-12-4-9(3-11(17)7-12)14-6-10-5-13(18)16(20-2)8-15(10)21-14/h3-8,17-18H,1-2H3 |
| SMILES |
c1(c(cc2c(c1)oc(c2)c1cc(cc(c1)O)OC)O)OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Moraceae | Morus alba  | Ref. |
| Plantae | Moraceae | Morus sp. | Ref. |
|
|
zoom in
| Organism | Morus alba |
|---|
| Reference | Wang, et al., Handbook of Effective Components in Vegetal Medicines, People Health Press, Beijing, (1986).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|
