| Name |
(+)-Zeylenol |
| Formula |
C21H20O7 |
| Mw |
384.12090299 |
| CAS RN |
113532-12-0 |
| C_ID |
C00036322
, 
|
| InChIKey |
AWCUZBLYCWUTRL-SPUMAVIPNA-N |
| InChICode |
InChI=1S/C21H20O7/c22-17-12-11-16(28-20(25)15-9-5-2-6-10-15)18(23)21(17,26)13-27-19(24)14-7-3-1-4-8-14/h1-12,16-18,22-23,26H,13H2/t16-,17+,18+,21-/m0/s1 |
| SMILES |
[C@@H]1(C=C[C@H]([C@]([C@@H]1O)(COC(=O)c1ccccc1)O)O)OC(=O)c1ccccc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Piperaceae | Piper cubeba  | Ref. |
| Plantae | Zingiberaceae | Boesenbergia rotunda (L.) Mansf.Kulturpfl. | Ref. |
|
|
zoom in
| Organism | Piper cubeba |
|---|
| Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|
