Name |
1-Hydroxy-2,3,5-trimethoxyxanthone |
Formula |
C16H14O6 |
Mw |
302.07903818 |
CAS RN |
22804-49-5 |
C_ID |
C00036430
,
|
InChIKey |
FFVKXGZKJBHJMS-UHFFFAOYSA-N |
InChICode |
InChI=1S/C16H14O6/c1-19-9-6-4-5-8-13(17)12-10(22-15(8)9)7-11(20-2)16(21-3)14(12)18/h4-7,18H,1-3H3 |
SMILES |
c12c(oc3c(c1=O)c(c(c(c3)OC)OC)O)c(ccc2)OC |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Asteraceae | Erigeron breviscapus | Ref. |
Plantae | Gentianaceae | Frasera albicaulis | Ref. |
Plantae | Gentianaceae | Frasera albomarginata | Ref. |
Plantae | Gentianaceae | Frasera caroliniensis | Ref. |
Plantae | Gentianaceae | Frasera speciosa | Ref. |
Plantae | Gentianaceae | Halenia asclepiadea | Ref. |
Plantae | Gentianaceae | Halenia campanulata | Ref. |
Plantae | Gentianaceae | Halenia corniculata | Ref. |
Plantae | Gentianaceae | Halenia elliptica | Ref. |
Plantae | Gentianaceae | Swertia milensis | Ref. |
Plantae | Gentianaceae | Swertia tetrapetala | Ref. |
Plantae | Gentianaceae | Veratrilla baillonii | Ref. |
|
|
zoom in
Organism | Erigeron breviscapus | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Wang, et al., Chinese Traditional and Herbal Drugs(Zhongcaoyao), 32, (2001), 577 |
---|
|