| Name |
Fuscaxanthone A |
| Formula |
C29H32O6 |
| Mw |
476.21988875 |
| CAS RN |
499777-91-2 |
| C_ID |
C00044768
, 
|
| InChIKey |
XDMFZDJOFFBFDK-LICLKQGHSA-N |
| InChICode |
InChI=1S/C29H32O6/c1-16(2)8-7-9-17(3)10-11-19-24-22(14-20(30)28(19)33-6)34-23-15-21-18(12-13-29(4,5)35-21)26(31)25(23)27(24)32/h8,10,12-15,30-31H,7,9,11H2,1-6H3/b17-10+ |
| SMILES |
c1(c(c(c2c(c1)oc1c(c2=O)c(c2c(c1)OC(C=C2)(C)C)O)C/C=C(\C)/CCC=C(C)C)OC)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia cowa  | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia fusca | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia schomburgkiana | Ref. |
|
|
zoom in
| Organism | Garcinia cowa |
|---|
| Reference | Anu Aravind, A. P. et al., Diversity of Garcinia species in the Western Ghats: Phytochemical Perspective (2017), 19-75, ISBN:978-81-924674-5-0 |
|---|
|
