| Name |
Nicotinamide
Vitamin B |
| Formula |
C6H6N2O |
| Mw |
122.04801283 |
| CAS RN |
98-92-0 |
| C_ID |
C00000209
, 
|
| InChIKey |
DFPAKSUCGFBDDF-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C6H6N2O/c7-6(9)5-2-1-3-8-4-5/h1-4H,(H2,7,9) |
| SMILES |
c1ccc(cn1)C(=O)N |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Arg L-Asp L-Phe L-His |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Bacteria | Enterobacteriaceae | Escherichia coli | Ref. |
| Plantae | Anemarrhenaceae | Anemarrhena asphodeloides  | Ref. |
| Plantae | Araceae | Pinellia pedatisecta | Ref. |
| Plantae | Asteraceae | Taraxacum formosanum | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Iridaceae | Crocus sativus | Ref. |
| Plantae | Saururaceae | Houttuynia cordata | Ref. |
| - | - | FOOD SAKE | Ref. |
|
|
zoom in
| Organism | Anemarrhena asphodeloides |
|---|
| Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
LI, et al., Chem Pharm Bull, 50, (2002), 1305.
LEU, et al., Chem Pharm Bull, 53, (2005), 853 |
|---|
|
