| Name |
Menthyl acetate |
| Formula |
C12H22O2 |
| Mw |
198.16197995 |
| CAS RN |
2623-23-6 |
| C_ID |
C00000850
, 
|
| InChIKey |
XHXUANMFYXWVNG-GMUICDJXNA-N |
| InChICode |
InChI=1S/C12H22O2/c1-8(2)11-6-5-9(3)7-12(11)14-10(4)13/h8-9,11-12H,5-7H2,1-4H3/t9-,11+,12-/m1/s1 |
| SMILES |
C1C[C@H]([C@@H](C[C@@H]1C)OC(=O)C)C(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Labiatae | Cunila angustifolia | Ref. |
| Plantae | Labiatae | Mentha haplocalyx  | Ref. |
| Plantae | Labiatae | Mentha piperita | Ref. |
| Plantae | Labiatae | Ocimum basilicum | Ref. |
|
|
zoom in
| Organism | Mentha haplocalyx |
|---|
| Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|
