| Name |
Tiglic acid |
| Formula |
C5H8O2 |
| Mw |
100.0524295 |
| CAS RN |
80-59-1 |
| C_ID |
C00001207
, 
|
| InChIKey |
UIERETOOQGIECD-ONEGZZNKSA-N |
| InChICode |
InChI=1S/C5H8O2/c1-3-4(2)5(6)7/h3H,1-2H3,(H,6,7)/b4-3+ |
| SMILES |
C(=C\C)(/C(=O)O)\C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Angelica archangelica  | Ref. |
| Plantae | Apiaceae | Angelica pubescens f.biserrata | Ref. |
| Plantae | Apiaceae | Daucus carota | Ref. |
| Plantae | Asteraceae | Anthemis nobilis | Ref. |
| Plantae | Convolvulaceae | Cuscuta chinensis | Ref. |
| Plantae | Euphorbiaceae | Croton tiglium | Ref. |
| - | - | Flavouring ingredient | Ref. |
|
|
zoom in
| Organism | Angelica pubescens f.biserrata |
|---|
| Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|
