| Name |
Sarmentosin |
| Formula |
C11H17NO7 |
| Mw |
275.10050191 |
| CAS RN |
71933-54-5 |
| C_ID |
C00001455
, 
|
| InChIKey |
FWAYDNJCBHNWQD-XTSCYBBYNA-N |
| InChICode |
InChI=1S/C11H17NO7/c12-3-6(4-13)1-2-18-11-10(17)9(16)8(15)7(5-14)19-11/h1,7-11,13-17H,2,4-5H2/b6-1+/t7-,8-,9+,10+,11-/m1/s1 |
| SMILES |
C(O[C@H]1[C@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)/C=C(\C |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Pro L-Arg L-Ala L-Asp |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Celastraceae | Euonymus japonicus  | Ref. |
| Plantae | Crassulaceae | Rhodiola sacra | Ref. |
| Plantae | Crassulaceae | Sedum sarmentosum | Ref. |
| Plantae | Crassulaceae | Sedum stenopetalum | Ref. |
| Plantae | Grossulariaceae | Ribes fasciculatum var.chinense | Ref. |
| Plantae | Grossulariaceae | Ribes nigrum | Ref. |
| Plantae | Piperaceae | Piper sarmentosum | Ref. |
|
|
zoom in
| Organism | Rhodiola sacra |
|---|
| Reference | Fan, et al., Bopl Pharm Bull, 22, (1999), 157.
Dat, et al., Chem Pharm Bull, 53, (2005), 114.
Ou, et al., Brief Handbook of Components of Traditional Chinese Medicines, The People's Medical Publishing House, Beijing, (2003).
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009) |
|---|
|
