| Name |
Juliflorine |
| Formula |
C40H75N3O2 |
| Mw |
629.58592866 |
| CAS RN |
76202-00-1 |
| C_ID |
C00002049
, 
|
| InChIKey |
JOTBJXJGDRSICD-FJLJVDGANA-N |
| InChICode |
InChI=1S/C40H75N3O2/c1-32-39(44)27-25-36(41-32)22-17-13-9-5-3-7-11-15-20-34-30-35(38-24-19-29-43(38)31-34)21-16-12-8-4-6-10-14-18-23-37-26-28-40(45)33(2)42-37/h30,32-33,35-42,44-45H,3-29,31H2,1-2H3/t32-,33-,35+,36-,37+,38-,39-,40-/m0/s1 |
| SMILES |
[C@H]1([C@@H](N[C@@H](CC1)CCCCCCCCCC[C@@H]1C=C(CN2[C@H]1CCC2)CCCCCCCCCC[C@H]1CC[C@@H]([C@@H](N1)C)O)C)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Pro L-Lys L-Arg L-Ala L-Asp |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Prosopis juliflora  | Ref. |
| - | - | prosopis juliflora | Ref. |
|
|
zoom in
| Organism | prosopis juliflora |
|---|
| Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|
