| Name |
Nigrifactin |
| Formula |
C12H17N |
| Mw |
175.13609955 |
| CAS RN |
23943-03-5 |
| C_ID |
C00002059
, 
|
| InChIKey |
DHQABWCNLXWKMG-ILWUCBPQSA-N |
| InChICode |
InChI=1S/C12H17N/c1-2-3-4-5-6-9-12-10-7-8-11-13-12/h2-6,9H,7-8,10-11H2,1H3/b3-2+,5-4+,9-6+ |
| SMILES |
C1CN=C(CC1)/C=C/C=C/C=C/C |
| Start Substs in Alk. Biosynthesis (Prediction) |
Anthranilate L-Lys |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Bacteria | Streptomycetaceae | Streptomyces spp. | Ref. |
| - | - | Unsteadiness mould's metabolite | Ref. |
|
|
zoom in
| Organism | Unsteadiness mould's metabolite |
|---|
| Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|
