| Name |
Lasiocarpine |
| Formula |
C21H33NO7 |
| Mw |
411.22570242 |
| CAS RN |
303-34-4 |
| C_ID |
C00002097
, 
|
| InChIKey |
QHOZSLCIKHUPSU-WMZRPMCLNA-N |
| InChICode |
InChI=1S/C21H33NO7/c1-7-13(2)18(23)29-16-9-11-22-10-8-15(17(16)22)12-28-19(24)21(26,14(3)27-6)20(4,5)25/h7-8,14,16-17,25-26H,9-12H2,1-6H3/b13-7-/t14-,16+,17-,21+/m1/s1 |
| SMILES |
[C@@H]12N(CC=C1COC(=O)[C@@](C(C)(O)C)(O)[C@@H](C)OC)CC[C@@H]2OC(=O)/C(=C\C)/C |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Arg Cholesterol |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Senecio oryzetorum | Ref. |
| Plantae | Boraginaceae | Cynoglossum officinale  | Ref. |
| Plantae | Boraginaceae | Heliotropium arbainense | Ref. |
| Plantae | Boraginaceae | Heliotropium curassavicum | Ref. |
| Plantae | Boraginaceae | Heliotropium europaeum | Ref. |
| Plantae | Boraginaceae | Heliotropium hirsutum | Ref. |
| Plantae | Boraginaceae | Heliotropium lasiocarpum | Ref. |
| Plantae | Boraginaceae | Heliotropium olgae | Ref. |
| Plantae | Boraginaceae | Lappula intermedia | Ref. |
| Plantae | Boraginaceae | Symphytum asperum | Ref. |
| Plantae | Boraginaceae | Symphytum caucasicum | Ref. |
| Plantae | Boraginaceae | Symphytum officinale | Ref. |
| Plantae | Boraginaceae | Symphytum officinalis | Ref. |
|
|
zoom in
| Organism | Cynoglossum officinale |
|---|
| Reference | Ji, et al., Pharmacological Action and Application of Available Antitumor Composition of Traditional Chinese Medicine, Heilongjiang Science and technology Press, Heilongjiang, (1998).
Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|
