| Name |
Aspidinol |
| Formula |
C12H16O4 |
| Mw |
224.104859 |
| CAS RN |
519-40-4 |
| C_ID |
C00002691
, 
|
| InChIKey |
GJRJTYFSORWKBE-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C12H16O4/c1-4-5-8(13)11-9(14)6-10(16-3)7(2)12(11)15/h6,14-15H,4-5H2,1-3H3 |
| SMILES |
c1(cc(c(c(c1C(=O)CCC)O)C)OC)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Dryopteridaceae | Dryopteris austriaca | Ref. |
| Plantae | Dryopteridaceae | Dryopteris crassirhizoma | Ref. |
| Plantae | Dryopteridaceae | Dryopteris filix-mas  | Ref. |
| Plantae | Polypodiaceae | Aspidium filix-mas | Ref. |
| Plantae | Woodsiaceae/Dryopteridaceae | Athyrium filix-femina | Ref. |
|
|
zoom in
| Organism | Dryopteris crassirhizoma |
|---|
| Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979). |
|---|
|
