| Name |
Procyanidin B4
Catechin-(4alpha->8)-epicatechin |
| Formula |
C30H26O12 |
| Mw |
578.1424263 |
| CAS RN |
29106-51-2 |
| C_ID |
C00002935
, 
|
| InChIKey |
XFZJEEAOWLFHDH-MDUHQJCGNA-N |
| InChICode |
InChI=1S/C30H26O12/c31-13-7-20(37)24-23(8-13)41-29(12-2-4-16(33)19(36)6-12)27(40)26(24)25-21(38)10-17(34)14-9-22(39)28(42-30(14)25)11-1-3-15(32)18(35)5-11/h1-8,10,22,26-29,31-40H,9H2/t22-,26+,27-,28-,29+/m0/s1 |
| SMILES |
[C@H]1([C@@H](Oc2c(C1)c(cc(c2[C@@H]1[C@@H]([C@H](Oc2c1c(cc(c2)O)O)c1ccc(c(c1)O)O)O)O)O)c1ccc(c(c1)O)O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Adoxaceae | Viburnum burkwoodii | Ref. |
| Plantae | Celastraceae | Tripterygium hypoglaucum | Ref. |
| Plantae | Ericaceae | Vaccinium myritillus | Ref. |
| Plantae | Ericaceae | Vaccinium vitis-idaea  | Ref. |
| Plantae | Fabaceae | Arachis hypogaea | Ref. |
| Plantae | Fabaceae | Vicia faba | Ref. |
| Plantae | Lauraceae | Laurus nobilis | Ref. |
| Plantae | Malvaceae | Theobroma cacao | Ref. |
| Plantae | Rosaceae | Coleogyne ramosissima Torr. | Ref. |
| Plantae | Rosaceae | Cowania mexicana | Ref. |
| Plantae | Rosaceae | Crataegus oxyacantha | Ref. |
| Plantae | Rosaceae | Malus spp. | Ref. |
| Plantae | Rosaceae | Rubus fruticosus | Ref. |
| Plantae | Rosaceae | Rubus idaeus | Ref. |
| Plantae | Sapindaceae | Aesculus hippocastanum | Ref. |
| Plantae | Theaceae | Camellia sinensis | Ref. |
| Plantae | Vitaceae | Vitis vinifera | Ref. |
|
|
zoom in
| Organism | Tripterygium hypoglaucum |
|---|
| Reference | Zhang, et al., CCMM, 23, (1998), 549.
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Gali, et al., Planta Med, 60, (1994), 235.
Chem Abstr, 124, (1996), 115826v.
Lou, et al., Phytochemistry, 65, (2004), 2391 |
|---|
|
