| Name |
alpha-Ylangene |
| Formula |
C15H24 |
| Mw |
204.18780077 |
| CAS RN |
14912-44-8 |
| C_ID |
C00003203
, 
|
| InChIKey |
VLXDPFLIRFYIME-FFWCQKOCNA-N |
| InChICode |
InChI=1S/C15H24/c1-9(2)11-7-8-15(4)12-6-5-10(3)14(15)13(11)12/h5,9,11-14H,6-8H2,1-4H3/t11-,12+,13+,14-,15-/m0/s1 |
| SMILES |
[C@@]12([C@@H]3[C@H]([C@@H](CC1)C(C)C)[C@H]2CC=C3C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Ganodermataceae | Ganoderma lucidum  | Ref. |
| Plantae | Annonaceae | Cananga odorata | Ref. |
| Plantae | Annonaceae | Guatteriopsis blepharophylla | Ref. |
| Plantae | Annonaceae | Guatteriopsis hispida | Ref. |
| Plantae | Annonaceae | Xylopia aethiopica | Ref. |
| Plantae | Annonaceae | Xylopia parviflora | Ref. |
| Plantae | Betulaceae | Betula sp. | Ref. |
| Plantae | Cistaceae | Cistus creticus | Ref. |
| Plantae | Cupressaceae | Juniperus oxycedrus | Ref. |
| Plantae | Fabaceae | Rhynchosia minima | Ref. |
| Plantae | Gymnomitriaceae | Marsupella emarginata | Ref. |
| Plantae | Labiatae | Rosmarinus officinalis | Ref. |
| Plantae | Lepidoziaceae | Lepidozia fauriana | Ref. |
| Plantae | Lepidoziaceae | Lepidozia vitrea | Ref. |
| Plantae | Meliaceae | Guarea macrophylla ssp.tuberculata | Ref. |
| Plantae | Pinaceae | Cedrus libani | Ref. |
| Plantae | Pinaceae | Pinus sibirica | Ref. |
| Plantae | Pinaceae | Pinus sylvestris | Ref. |
| Plantae | Piperaceae | Piper nigrum | Ref. |
| Plantae | Rutaceae | Citrus wilsonii | Ref. |
| Plantae | Rutaceae | Fortunella margarita | Ref. |
| Plantae | Rutaceae | Murraya paniculata | Ref. |
| Plantae | Rutaceae | Poncirus trifoliate x Citrus sinensis | Ref. |
| Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana officinalis | Ref. |
|
|
zoom in
| Organism | Cananga odorata |
|---|
| Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999)
Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter50 |
|---|
|
