| Name |
Michelenolide |
| Formula |
C15H20O4 |
| Mw |
264.13615913 |
| CAS RN |
66392-96-9 |
| C_ID |
C00003327
, 
|
| InChIKey |
ZNURDDCKOFUOKI-MPCIWCJANA-N |
| InChICode |
InChI=1S/C15H20O4/c1-8-9-4-6-14(2)10(18-14)5-7-15(3)12(19-15)11(9)17-13(8)16/h9-12H,1,4-7H2,2-3H3/t9-,10+,11-,12+,14+,15?/m0/s1 |
| SMILES |
[C@H]12[C@@H](CC[C@@]3([C@@H](CC[C@@]4([C@@H]1O4)C)O3)C)C(=C)C(=O)O2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Anthemis macedonica | Ref. |
| Plantae | Asteraceae | Carpesium longifolium | Ref. |
| Plantae | Magnoliaceae | Michelia compressa | Ref. |
|
|
zoom in
| Organism | Carpesium longifolium |
|---|
| Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Yang, et al., Journal of Natural Products, 66, (2003), 1554 |
|---|
|
