| Name |
Withaferin A |
| Formula |
C28H38O6 |
| Mw |
470.26683895 |
| CAS RN |
5119-48-2 |
| C_ID |
C00003676
, 
|
| InChIKey |
DBRXOUCRJQVYJQ-BNDJEQFSNA-N |
| InChICode |
InChI=1S/C28H38O6/c1-14-11-21(33-25(32)17(14)13-29)15(2)18-5-6-19-16-12-24-28(34-24)23(31)8-7-22(30)27(28,4)20(16)9-10-26(18,19)3/h7-8,15-16,18-21,23-24,29,31H,5-6,9-13H2,1-4H3/t15-,16-,18+,19-,20-,21+,23-,24+,26+,27-,28+/m0/s1 |
| SMILES |
C1=C[C@@H]([C@]23[C@](C1=O)([C@@H]1[C@@H](C[C@H]2O3)[C@H]2[C@](CC1)([C@H](CC2)[C@@H]([C@H]1CC(=C(C(=O)O1)CO)C)C)C)C)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Solanaceae | Acnistus arborescens  | Ref. |
| Plantae | Solanaceae | Solanum torvum | Ref. |
| Plantae | Solanaceae | Withania ashwagandha | Ref. |
| Plantae | Solanaceae | Withania coagulans | Ref. |
| Plantae | Solanaceae | Withania somnifera | Ref. |
|
|
zoom in
| Organism | Solanum torvum |
|---|
| Reference | Ji, et al., Pharmacological Action and Application of Available Antitumor Composition of Traditional Chinese Medicine, Heilongjiang Science and technology Press, Heilongjiang, (1998).
Choudhary, et al., Chem Pharm Bull, 52, (2004), 1358.
ZHAO, et al., Chem Pharm Bull, 50, (2002), 760.
Misra, et al., Phytochemistry, 66, (2005), 2702 |
|---|
|
