Name |
Tectochrysin 5-hydroxy-7-methoxyflavone |
Formula |
C16H12O4 |
Mw |
268.07355887 |
CAS RN |
520-28-5 |
C_ID |
C00003795
, 
|
InChIKey |
IRZVHDLBAYNPCT-UHFFFAOYSA-N |
InChICode |
InChI=1S/C16H12O4/c1-19-11-7-12(17)16-13(18)9-14(20-15(16)8-11)10-5-3-2-4-6-10/h2-9,17H,1H3 |
SMILES |
c1(cc(c2c(c1)oc(cc2=O)c1ccccc1)O)OC |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Annonaceae | Uvaria rufa | Ref. |
Plantae | Asteraceae | Baccharis viminea | Ref. |
Plantae | Asteraceae | Flourensia laurifolia | Ref. |
Plantae | Asteraceae | Lychnophora markgravii | Ref. |
Plantae | Bignoniaceae | Godmania aesculifolia | Ref. |
Plantae | Boraginaceae | Heliotropium pycnophyllum | Ref. |
Plantae | Cistaceae | Cistus populifolius | Ref. |
Plantae | Geraniaceae | Pelargonium crispum  | Ref. |
Plantae | Labiatae | Collinsonia canadensis  | Ref. |
Plantae | Labiatae | Hoslundia opposita  | Ref. |
Plantae | Myricaceae | Comptonia peregrina  | Ref. |
Plantae | Pinaceae | Pinus spp.  | Ref. |
Plantae | Piperaceae | Piper manii | Ref. |
Plantae | Piperaceae | Piper sylvaticum Roxb.  | Ref. |
Plantae | Rosaceae | Prunus avium  | Ref. |
Plantae | Rosaceae | Prunus cerasus  | Ref. |
Plantae | Rosaceae | Prunus spp.  | Ref. |
Plantae | Salicaceae | Populus davidiana | Ref. |
Plantae | Salicaceae | Populus spp. | Ref. |
Plantae | Stilbaceae | Nuxia sphaerocephala  | Ref. |
Plantae | Taxaceae | Taxus chinensis | Ref. |
Plantae | Zingiberaceae | Alpinia oxyphylla  | Ref. |
Plantae | Zingiberaceae | Boesenbergia pandurata  | Ref. |
Plantae | Zingiberaceae | Kaempferia parviflora  | Ref. |
|
|
zoom in
Organism | Baccharis viminea | Reference | Wollenweber,Proceeding of the International Compositae Conference,vol 1,(1994)
Hind,Royal Botanic Gardens,Kew,(1996)
Wollenweber,Naturforsch.,52c,(1997),301 |
---|
|