Name |
6-Hydroxyluteolin 6-methyl ether Pedalitin 3',4',5,6-Tetrahydroxy-7-methoxyflavone 2-(3,4-Dihydroxyphenyl)-5,6-dihydroxy-7-methoxy-4H-1-benzopyran-4-one |
Formula |
C16H12O7 |
Mw |
316.05830274 |
CAS RN |
22384-63-0 |
C_ID |
C00003886
,
|
InChIKey |
QWUHUBDKQQPMQG-UHFFFAOYSA-N |
InChICode |
InChI=1S/C16H12O7/c1-22-13-6-12-14(16(21)15(13)20)10(19)5-11(23-12)7-2-3-8(17)9(18)4-7/h2-6,17-18,20-21H,1H3 |
SMILES |
c1(c(c(c2c(c1)oc(cc2=O)c1ccc(c(c1)O)O)O)O)OC |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Asteraceae | Artemisia vestita | Ref. |
Plantae | Asteraceae | Eupatorium inulaefolium | Ref. |
Plantae | Asteraceae | Tanacetum vulgare L. | Ref. |
Plantae | Asteraceae | Viguiera spp. | Ref. |
Plantae | Eriocaulaceae | Leiothrix flavescens | Ref. |
Plantae | Fabaceae | Pterogyne nitens | Ref. |
Plantae | Hydrocharitaceae | Halophila johnsonii | Ref. |
Plantae | Jubulaceae | Frullania dilatata | Ref. |
Plantae | Jubulaceae | Frullania spp. | Ref. |
Plantae | Labiatae | Isodon rubescens var.lushiensis | Ref. |
Plantae | Labiatae | Mentha pulegium | Ref. |
Plantae | Labiatae | Salvia blepharophylla | Ref. |
Plantae | Lamiaceae | Rabdosia rubescens | Ref. |
Plantae | Monocleaceae | Monoclea gottschei | Ref. |
Plantae | Pedaliaceae | Sesamum indicum | Ref. |
Plantae | Saxifragaceae | Sullivantia spp. | Ref. |
|
|
zoom in
Organism | Eupatorium inulaefolium | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Harborne,Comparative Biochemistry of the Flavonods,1967,Academic Press
Neuman,P.,J.Nat.Prod.,44,(1981),50 |
---|
|