| Name |
6-Hydroxyluteolin 6,3'-dimethyl ether 7-glucoside |
| Formula |
C23H24O12 |
| Mw |
492.12677623 |
| CAS RN |
25474-11-7 |
| C_ID |
C00004410
, 
|
| InChIKey |
YFZSQPRYLBGYKE-MEKDVCIUNA-N |
| InChICode |
InChI=1S/C23H24O12/c1-31-13-5-9(3-4-10(13)25)12-6-11(26)17-14(33-12)7-15(22(32-2)19(17)28)34-23-21(30)20(29)18(27)16(8-24)35-23/h3-7,16,18,20-21,23-25,27-30H,8H2,1-2H3/t16-,18-,20+,21+,23-/m1/s1 |
| SMILES |
c1(c(c(c2c(c1)oc(cc2=O)c1ccc(c(c1)OC)O)O)OC)O[C@H]1[C@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Centaurea jacea | Ref. |
| Plantae | Plantaginaceae | Digitalis lanata  | Ref. |
|
|
zoom in
| Organism | Digitalis lanata |
|---|
| Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 3.Flavone O-glycosides, John Wiley & Son
Wagner,Tetrahedron Lett.,(1969),3411 |
|---|
|
