| Name |
Kaempferol 3-O-sulfate
Kaempferol-3-sulfate |
| Formula |
C15H10O9S |
| Mw |
366.00455265 |
| CAS RN |
62369-24-8 |
| C_ID |
C00004945
, 
|
| InChIKey |
VOYLAWHADGDBIE-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H10O9S/c16-8-3-1-7(2-4-8)14-15(24-25(20,21)22)13(19)12-10(18)5-9(17)6-11(12)23-14/h1-6,16-18H,(H,20,21,22) |
| SMILES |
c1(cc(c2c(c1)oc(c(c2=O)OS(=O)(=O)O)c1ccc(cc1)O)O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Dilleniaceae | Acrotrema uniflorum | Ref. |
| Plantae | Pteridaceae | Adiantum capillus-veneris  | Ref. |
|
|
zoom in
| Organism | Adiantum capillus-veneris |
|---|
| Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|
