| Name |
Quercetin 3-O-sulfate |
| Formula |
C15H10O10S |
| Mw |
381.99946727 |
| CAS RN |
60889-05-6 |
| C_ID |
C00004956
, 
|
| InChIKey |
DNAYVNOVGHZZLH-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H10O10S/c16-7-4-10(19)12-11(5-7)24-14(6-1-2-8(17)9(18)3-6)15(13(12)20)25-26(21,22)23/h1-5,16-19H,(H,21,22,23) |
| SMILES |
c1(cc(c2c(c1)oc(c(c2=O)OS(=O)(=O)O)c1ccc(c(c1)O)O)O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Ammi visnaga  | Ref. |
| Plantae | Apiaceae | Oenanthe crocata | Ref. |
| Plantae | Asteraceae | Flaveria bidentis | Ref. |
| Plantae | Asteraceae | Flaveria chloraefolia | Ref. |
|
|
zoom in
| Organism | Oenanthe crocata |
|---|
| Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Harborne,Biochem.Syst.Ecol.,4,(1976),111 |
|---|
|
