Name |
Quercetin 3-O-beta-D-glucopyranosyl-7-O-alpha-L-rhamnopyranoside Quercetin 3-O-glucoside-7-O-rhamnoside Quercetin 3-glucoside-7-rhamnoside |
Formula |
C27H30O16 |
Mw |
610.15338491 |
CAS RN |
18016-58-5 |
C_ID |
C00005428
,
|
InChIKey |
OTUCXMIQUNROBJ-FVQHZYONNA-N |
InChICode |
InChI=1S/C27H30O16/c1-8-17(32)20(35)22(37)26(39-8)40-10-5-13(31)16-14(6-10)41-24(9-2-3-11(29)12(30)4-9)25(19(16)34)43-27-23(38)21(36)18(33)15(7-28)42-27/h2-6,8,15,17-18,20-23,26-33,35-38H,7H2,1H3/t8-,15+,17-,18+,20-,21-,22+,23+,26-,27-/m0/s1 |
SMILES |
c1(cc(c2c(c1)oc(c(c2=O)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)c1ccc(c(c1)O)O)O)O[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)C)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Annonaceae | Porcelia macrocarpa | Ref. |
Plantae | Apocynaceae | Vincetoxicum officinale | Ref. |
Plantae | Aspleniaceae | Asplenium trichomanes-ramosum | Ref. |
Plantae | Asteraceae | Liatris spicata | Ref. |
Plantae | Celastraceae | Celastrus orbiculatus | Ref. |
Plantae | Crassulaceae | Kalanchoe spathulata | Ref. |
Plantae | Crassulaceae | Sinocrassula indica | Ref. |
Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
Plantae | Cruciferae | Erysimum perofskianum | Ref. |
Plantae | Cucurbitaceae | Marah oreganus | Ref. |
Plantae | Equisetaceae | Equisetum silvaticum | Ref. |
Plantae | Fabaceae | Coronilla emerus | Ref. |
Plantae | Fabaceae | Lathyrus chrysanthus | Ref. |
Plantae | Fabaceae | Macroptilium lathyroides | Ref. |
Plantae | Fabaceae | Vicia spp. | Ref. |
Plantae | Malvaceae | Tilia argentea | Ref. |
Plantae | Phytolaccaceae | Phytolacca dodecandra | Ref. |
|
|
zoom in
Organism | Vincetoxicum officinale | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Kozjek,Ann.Parm.Fr.,26,(1968),513 |
---|
|