Name |
Quercetin 3-rutinoside-7-glucoside |
Formula |
C33H40O21 |
Mw |
772.20620834 |
CAS RN |
30311-61-6 |
C_ID |
C00005472
,
|
InChIKey |
SPUFXPFDJYNCFD-UOGUVAJPNA-N |
InChICode |
InChI=1S/C33H40O21/c1-9-19(38)23(42)26(45)31(49-9)48-8-17-21(40)25(44)28(47)33(53-17)54-30-22(41)18-14(37)5-11(50-32-27(46)24(43)20(39)16(7-34)52-32)6-15(18)51-29(30)10-2-3-12(35)13(36)4-10/h2-6,9,16-17,19-21,23-28,31-40,42-47H,7-8H2,1H3/t9-,16-,17-,19+,20-,21-,23+,24+,25+,26-,27-,28-,31-,32-,33+/m1/s1 |
SMILES |
c1(cc(c2c(c1)oc(c(c2=O)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO[C@H]1[C@@H]([C@H]([C@H]([C@H](O1)C)O)O)O)O)O)O)c1ccc(c(c1)O)O)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Annonaceae | Asimina triloba | Ref. |
Plantae | Campanulaceae/Lobeliaceae | Campanula persicifolia | Ref. |
Plantae | Fabaceae | Baptisia alba | Ref. |
Plantae | Fabaceae | Lathyrus aphaca | Ref. |
Plantae | Liliaceae | Tulipa gesneriana | Ref. |
Plantae | Limnanthaceae | Limnanthes douglasii | Ref. |
Plantae | Oleaceae | Osmanthus americanus | Ref. |
Plantae | Polemoniaceae | Linanthus spp. | Ref. |
Plantae | Solanaceae | Leucophysalis spp. | Ref. |
Plantae | Solanaceae | Lycium halimifolium | Ref. |
Plantae | Solanaceae | Nicotiana tabacum | Ref. |
Plantae | Solanaceae | Oryctes nevadensis | Ref. |
Plantae | Solanaceae | Withania somnifera | Ref. |
Plantae | Zygophyllaceae | Tribulus pentandrus | Ref. |
|
|
zoom in
Organism | Campanula persicifolia | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Watanabe,Arch.Biochem.Biophys.,112,(1965),111 |
---|
|