Name |
Bilobetin |
Formula |
C31H20O10 |
Mw |
552.10564686 |
CAS RN |
521-32-4 |
C_ID |
C00006488
,
|
InChIKey |
IWEIJEPIYMAGTH-UHFFFAOYSA-N |
InChICode |
InChI=1S/C31H20O10/c1-39-24-7-4-15(26-12-22(37)29-19(34)9-17(33)10-27(29)40-26)8-18(24)28-20(35)11-21(36)30-23(38)13-25(41-31(28)30)14-2-5-16(32)6-3-14/h2-13,32-36H,1H3 |
SMILES |
c1c(c(ccc1c1oc2c(c(=O)c1)c(cc(c2)O)O)OC)c1c(cc(c2c1oc(cc2=O)c1ccc(cc1)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Araucariaceae | Araucaria bidwillii | Ref. |
Plantae | Boweniaceae | Bowenia spp. | Ref. |
Plantae | Cupressaceae | Juniperus communis | Ref. |
Plantae | Ginkgoaceae | Ginkgo biloba | Ref. |
Plantae | Podocarpaceae | Dacrydium spp. | Ref. |
Plantae | Podocarpaceae | Lepidothamnus spp. | Ref. |
Plantae | Podocarpaceae | Podocarpus elongatus | Ref. |
Plantae | Podocarpaceae | Podocarpus montanus | Ref. |
Plantae | Podocarpaceae | Prumnopitys spp. | Ref. |
Plantae | Taxaceae | Torreya nucifera | Ref. |
Plantae | Taxodiaceae | Taxodium distichum | Ref. |
Plantae | Zamiaceae | Dioon spp. | Ref. |
Plantae | Zamiaceae | Encephalartos spp. | Ref. |
Plantae | Zamiaceae | Macrozamia spp. | Ref. |
Plantae | Zamiaceae | Microcycas spp. | Ref. |
Plantae | Zamiaceae | Zamia spp. | Ref. |
|
|
zoom in
Organism | Bowenia spp. | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 645,Biflavonyls
Baker,J.Chem.Soc.,(1963),1477 |
---|
|