| Name |
Persicogenin |
| Formula |
C17H16O6 |
| Mw |
316.09468824 |
| CAS RN |
28590-40-1 |
| C_ID |
C00008300
, 
|
| InChIKey |
LWBHKKLWSUFUNZ-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C17H16O6/c1-21-10-6-12(19)17-13(20)8-15(23-16(17)7-10)9-3-4-14(22-2)11(18)5-9/h3-7,15,18-19H,8H2,1-2H3/t15-/m0/s1 |
| SMILES |
c1(cc(c2c(c1)O[C@@H](CC2=O)c1ccc(c(c1)O)OC)O)OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Pteridaceae | Notholaena spp. | Ref. |
| Plantae | Rosaceae | Prunus davidiana  | Ref. |
| Plantae | Rosaceae | Prunus persica | Ref. |
| - | - | Persica vulgaris | Ref. |
|
|
zoom in
| Organism | Prunus davidiana |
|---|
| Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|
