| Name |
Calycosin
Cyclosin
3'-Hydroxyformononetin |
| Formula |
C16H12O5 |
| Mw |
284.06847349 |
| CAS RN |
20575-57-9 |
| C_ID |
C00009389
, 
|
| InChIKey |
ZZAJQOPSWWVMBI-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O5/c1-20-14-5-2-9(6-13(14)18)12-8-21-15-7-10(17)3-4-11(15)16(12)19/h2-8,17-18H,1H3 |
| SMILES |
c1(ccc2c(c1)occ(c2=O)c1cc(c(cc1)OC)O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Convolvulaceae | Erycibe expansa  | Ref. |
| Plantae | Fabaceae | Andira inermis | Ref. |
| Plantae | Fabaceae | Astragalus mongholicus | Ref. |
| Plantae | Fabaceae | Baptisia spp. | Ref. |
| Plantae | Fabaceae | Bowdichia nitida | Ref. |
| Plantae | Fabaceae | Dalbergia parviflora | Ref. |
| Plantae | Fabaceae | Erythrina latissima | Ref. |
| Plantae | Fabaceae | Glycyrrhiza pallidiflora | Ref. |
| Plantae | Fabaceae | Machaerium mucronulatum | Ref. |
| Plantae | Fabaceae | Machaerium vestitum | Ref. |
| Plantae | Fabaceae | Machaerium villosum | Ref. |
| Plantae | Fabaceae | Medicago truncatula | Ref. |
| Plantae | Fabaceae | Melilotus messanensis | Ref. |
| Plantae | Fabaceae | Millettia laurentii | Ref. |
| Plantae | Fabaceae | Myroxylon balsamum | Ref. |
| Plantae | Fabaceae | Psorothamnus arborescens | Ref. |
| Plantae | Fabaceae | Sophora flavescens | Ref. |
| Plantae | Fabaceae | Sophora fraseri | Ref. |
| Plantae | Fabaceae | Sophora secundiflora | Ref. |
|
|
zoom in
| Organism | Andira inermis |
|---|
| Reference | Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009).
Chacha, et al., Phytochemistry, 66, (2005), 99.
Kraft, et al., Phytochemistry, 58, (2001), 769.
Matsuda, et al., Planta Med, 70, (2004), 1201.
Erasto, et al., Phytochemistry, 65, (2004), 875.
Cui, et al., Natural Product Research and Development(Tianran Chanwu Yanjiu Yu Kaifa), 14, (2002), 72.
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11. |
|---|
|
