Name |
Trifolirhizin Sophojaponicin B1 (-)-Maackiain 3-O-glucoside |
Formula |
C22H22O10 |
Mw |
446.12129692 |
CAS RN |
6807-83-6 |
C_ID |
C00010186
,
|
InChIKey |
VGSYCWGXBYZLLE-JSYCUEOGNA-N |
InChICode |
InChI=1S/C22H22O10/c23-6-17-18(24)19(25)20(26)22(32-17)30-9-1-2-10-13(3-9)27-7-12-11-4-15-16(29-8-28-15)5-14(11)31-21(10)12/h1-5,12,17-26H,6-8H2/t12-,17+,18+,19-,20+,21-,22+/m0/s1 |
SMILES |
O(c1cc2c([C@H]3[C@@H](CO2)c2c(O3)cc3c(c2)OCO3)cc1)[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Fabaceae | Baptisia australis | Ref. |
Plantae | Fabaceae | Cicer spp. | Ref. |
Plantae | Fabaceae | Euchresta formosana | Ref. |
Plantae | Fabaceae | Euchresta japonica | Ref. |
Plantae | Fabaceae | Glycyrrhiza pallidiflora | Ref. |
Plantae | Fabaceae | Ononis spinosa | Ref. |
Plantae | Fabaceae | Sophora flavescens | Ref. |
Plantae | Fabaceae | Sophora subprostrata | Ref. |
Plantae | Fabaceae | Tephrosia spp. | Ref. |
Plantae | Fabaceae | Thermopsis spp. | Ref. |
Plantae | Fabaceae | Trifolium pratense | Ref. |
|
|
zoom in
Organism | Cicer spp. | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Lebreton,Phytochem.,6,(1967),1675 |
---|
|