| Name |
Garcinone E |
| Formula |
C28H32O6 |
| Mw |
464.21988875 |
| CAS RN |
112649-21-5 |
| C_ID |
C00030359
, 
|
| InChIKey |
WVJYEKGQSBGNRP-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C28H32O6/c1-14(2)7-10-17-20(29)13-21-23(24(17)30)27(33)22-18(11-8-15(3)4)25(31)26(32)19(28(22)34-21)12-9-16(5)6/h7-9,13,29-32H,10-12H2,1-6H3 |
| SMILES |
c12c(c(=O)c3c(o1)cc(c(c3O)CC=C(C)C)O)c(c(c(c2CC=C(C)C)O)O)CC=C(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia mangostana  | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia xipshuanbannaensis | Ref. |
| - | - | Garcina xipshuanbannaensis | Ref. |
|
|
zoom in
| Organism | Garcinia xipshuanbannaensis |
|---|
| Reference | Aravind, A. P. A et al., Diversity of Garcinia species in the Western Ghats: Phytochemical Perspective, Chapter 2, (2016), p.19-70. |
|---|
|
