| Name |
7-O-Methylgarcinone E |
| Formula |
C29H34O6 |
| Mw |
478.23553882 |
| CAS RN |
194090-67-0 |
| C_ID |
C00034778
, 
|
| InChIKey |
CYZRCBIQIBAFCQ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C29H34O6/c1-15(2)8-11-18-21(30)14-22-24(25(18)31)27(33)23-19(12-9-16(3)4)29(34-7)26(32)20(28(23)35-22)13-10-17(5)6/h8-10,14,30-32H,11-13H2,1-7H3 |
| SMILES |
c12c(c(=O)c3c(o1)c(c(c(c3CC=C(C)C)OC)O)CC=C(C)C)c(c(c(c2)O)CC=C(C)C)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia cowa  | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia fusca | Ref. |
|
|
zoom in
| Organism | Garcinia fusca |
|---|
| Reference | Aravind, A. P. A et al., Diversity of Garcinia species in the Western Ghats: Phytochemical Perspective, Chapter 2, (2016), p.19-70. |
|---|
|
