| Name |
Isostemonamine |
| Formula |
C18H23NO4 |
| Mw |
317.16270823 |
| CAS RN |
41758-67-2 |
| C_ID |
C00039456
, 
|
| InChIKey |
YRGLLFADJRHUKM-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C18H23NO4/c1-11-13-7-4-5-9-19-10-6-8-17(13,19)18(14(11)20)15(22-3)12(2)16(21)23-18/h4-10H2,1-3H3/t17-,18-/m1/s1 |
| SMILES |
[C@]123N(CCCCC1=C(C(=O)[C@]13C(=C(C(=O)O1)C)OC)C)CCC2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Pro L-Lys L-Arg L-Ala |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Stemonaceae | Stemona japonica  | Ref. |
| Plantae | Stemonaceae | Stemona sessilifolia | Ref. |
|
|
zoom in
| Organism | Stemona sessilifolia |
|---|
| Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|
