| Name |
Rotenone
Tubotoxin
Nicouline |
| Formula |
C23H22O6 |
| Mw |
394.14163844 |
| CAS RN |
83-79-4 |
| C_ID |
C00002568
, 
|
| InChIKey |
JUVIOZPCNVVQFO-BXPNWFCHNA-N |
| InChICode |
InChI=1S/C23H22O6/c1-11(2)16-8-14-15(28-16)6-5-12-22(24)21-13-7-18(25-3)19(26-4)9-17(13)27-10-20(21)29-23(12)14/h5-7,9,16,20-21H,1,8,10H2,2-4H3/t16-,20-,21+/m1/s1 |
| SMILES |
c12ccc3c(c1C[C@@H](O2)C(=C)C)O[C@H]1[C@@H](C3=O)c2c(OC1)cc(c(c2)OC)OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Convolvulaceae | Erycibe expansa  | Ref. |
| Plantae | Fabaceae | Derris eclipta | Ref. |
| Plantae | Fabaceae | Derris elliptica | Ref. |
| Plantae | Fabaceae | Derris malaccensis | Ref. |
| Plantae | Fabaceae | Derris trifoliata | Ref. |
| Plantae | Fabaceae | Lonchocarpus spp. | Ref. |
| Plantae | Fabaceae | Millettia pachycarpa | Ref. |
| Plantae | Fabaceae | Millettia pervilleana | Ref. |
| Plantae | Fabaceae | Millettia reticulata | Ref. |
| Plantae | Fabaceae | Millettia spp. | Ref. |
| Plantae | Fabaceae | Pachyrhizus erosus | Ref. |
| Plantae | Fabaceae | Pachyrrhizus erosus | Ref. |
| Plantae | Fabaceae | Piscidia erythrina | Ref. |
| Plantae | Fabaceae | Tephrosia interrupta Engl. | Ref. |
| Plantae | Fabaceae | Tephrosia linearis (Willd.) Pers. | Ref. |
| Plantae | Fabaceae | Tephrosia purpurea | Ref. |
| Plantae | Fabaceae | Tephrosia spp. | Ref. |
| Plantae | Scrophulariaceae | Verbascum thapsus | Ref. |
| Plantae | Taxaceae | Taxus chinensis | Ref. |
| Plantae | Taxaceae | Taxus fuana | Ref. |
| Plantae | Taxaceae | Taxus yunnanensis | Ref. |
| - | - | Leguminosae | Ref. |
| - | - | Milletia pachycarpa | Ref. |
| - | - | Papilionoideae | Ref. |
|
|
zoom in
| Organism | Pachyrhizus erosus |
|---|
| Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
PHRUTIVORAPONGKUL, et al., Chem Pharm Bull, 50, (2002), 534.
Granell, et al., Planta Med, 70, (2004), 266.
Ito, et al., Planta Med, 70, (2004), 585.
Barrachina, et al., Planta Med, 70, (2004), 866.
Betancur-Galvis, et al., Planta Med, 69, (2003), 177.
Gertsch, et al., Planta Med, 69, (2003), 420 |
|---|
|
