Name |
Tephrosin |
Formula |
C23H22O7 |
Mw |
410.13655306 |
CAS RN |
76-80-2 |
C_ID |
C00002578
,
|
InChIKey |
AQBZCCQCDWNNJQ-UUSWMZEJNA-N |
InChICode |
InChI=1S/C23H22O7/c1-22(2)8-7-12-15(30-22)6-5-13-20(12)29-19-11-28-16-10-18(27-4)17(26-3)9-14(16)23(19,25)21(13)24/h5-10,19,25H,11H2,1-4H3 |
SMILES |
c12ccc3c(c1C=CC(O2)(C)C)O[C@H]1[C@@](C3=O)(c2c(cc(c(c2)OC)OC)OC1)O |
Start Substs in Alk. Biosynthesis (Prediction) |
|
Organism |
Kingdom |
Family |
Species |
Reference |
Plantae | Convolvulaceae | Erycibe expansa | Ref. |
Plantae | Fabaceae | Amorpha fruticosa | Ref. |
Plantae | Fabaceae | Crotalaria spp. | Ref. |
Plantae | Fabaceae | Derris malaccensis | Ref. |
Plantae | Fabaceae | Derris oblonga | Ref. |
Plantae | Fabaceae | Derris trifoliata | Ref. |
Plantae | Fabaceae | Lonchocarpus longifolius | Ref. |
Plantae | Fabaceae | Lonchocarpus spp. | Ref. |
Plantae | Fabaceae | Lonchocarpus spruceanus | Ref. |
Plantae | Fabaceae | Millettia dura | Ref. |
Plantae | Fabaceae | Millettia ferruginea | Ref. |
Plantae | Fabaceae | Millettia oblata ssp. teitensis | Ref. |
Plantae | Fabaceae | Millettia taiwaniana | Ref. |
Plantae | Fabaceae | Mundulea sericea | Ref. |
Plantae | Fabaceae | Piscidia mollois | Ref. |
Plantae | Fabaceae | Tephrosia elata | Ref. |
Plantae | Fabaceae | Tephrosia spp. | Ref. |
- | - | Milletia dura | Ref. |
|
|
zoom in
Organism | Millettia ferruginea | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
ClarkJ.Am.Chem.Soc.,53,(1931),729
Delfel,J.Assoc.Off.Anal.Chem.,52,(1969),182 |
---|
|